C27H33N3O5S2 — CID 4923375
3-phenylpropyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate (PubChem CID 4923375) has the molecular formula C27H33N3O5S2 and a molecular weight of 543.71 g/mol. Its IUPAC name is 3-phenylpropyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923375 |
| Molecular Formula | C27H33N3O5S2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | 3-phenylpropyl 5-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioylamino]-5-oxopentanoate |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H33N3O5S2/c1-3-19-30(20-4-2)37(33,34)24-17-15-23(16-18-24)28-27(36)29-25(31)13-8-14-26(32)35-21-9-12-22-10-6-5-7-11-22/h3-7,10-11,15-18H,1-2,8-9,12-14,19-21H2,(H2,28,29,31,36) |
| InChIKey | YFTYGCADFUIVRY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|