C27H29N3O3S — CID 4923209
3-phenylpropyl 5-[(4-anilinophenyl)carbamothioylamino]-5-oxopentanoate (PubChem CID 4923209) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 3-phenylpropyl 5-[(4-anilinophenyl)carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[(4-anilinophenyl)carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923209 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-phenylpropyl 5-[(4-anilinophenyl)carbamothioylamino]-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OCCCc1ccccc1)NC(=S)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O3S/c31-25(14-7-15-26(32)33-20-8-11-21-9-3-1-4-10-21)30-27(34)29-24-18-16-23(17-19-24)28-22-12-5-2-6-13-22/h1-6,9-10,12-13,16-19,28H,7-8,11,14-15,20H2,(H2,29,30,31,34) |
| InChIKey | MSVNIYFCIIERMT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|