C26H34N4O5S2 — CID 4923345
3-phenylpropyl 5-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioylamino]-5-oxopentanoate (PubChem CID 4923345) has the molecular formula C26H34N4O5S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is 3-phenylpropyl 5-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923345 |
| Molecular Formula | C26H34N4O5S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 3-phenylpropyl 5-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioylamino]-5-oxopentanoate |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(NC(=S)NC(=O)CCCC(=O)OCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H34N4O5S2/c1-29-16-18-30(19-17-29)37(33,34)23-14-12-22(13-15-23)27-26(36)28-24(31)10-5-11-25(32)35-20-6-9-21-7-3-2-4-8-21/h2-4,7-8,12-15H,5-6,9-11,16-20H2,1H3,(H2,27,28,31,36) |
| InChIKey | SGXYRXCVZBBCML-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|