C28H31N3O6S2 — CID 4934759
3-phenylpropyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 4934759) has the molecular formula C28H31N3O6S2 and a molecular weight of 569.71 g/mol. Its IUPAC name is 3-phenylpropyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4934759 |
| Molecular Formula | C28H31N3O6S2 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 3-phenylpropyl 4-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)CCC(=O)OCCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H31N3O6S2/c1-2-36-24-14-10-23(11-15-24)31-39(34,35)25-16-12-22(13-17-25)29-28(38)30-26(32)18-19-27(33)37-20-6-9-21-7-4-3-5-8-21/h3-5,7-8,10-17,31H,2,6,9,18-20H2,1H3,(H2,29,30,32,38) |
| InChIKey | YJIBWOYCNZYWSB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|