C23H23N3O4S2 — CID 3308515
N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 3308515) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 3308515 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O4S2/c1-2-30-20-12-8-19(9-13-20)26-32(28,29)21-14-10-18(11-15-21)24-23(31)25-22(27)16-17-6-4-3-5-7-17/h3-15,26H,2,16H2,1H3,(H2,24,25,27,31) |
| InChIKey | UCLLVMCZQOUBBR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|