C20H20N4O3S2 — CID 25043088
1-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea (PubChem CID 25043088) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 25043088 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 1-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=S)Nc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C20H20N4O3S2/c1-2-27-18-9-5-16(6-10-18)24-29(25,26)19-11-7-15(8-12-19)22-20(28)23-17-4-3-13-21-14-17/h3-14,24H,2H2,1H3,(H2,22,23,28) |
| InChIKey | RCVRCUFYXPOCTD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|