C17H17N5O3S2 — CID 25045123
1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea (PubChem CID 25045123) has the molecular formula C17H17N5O3S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea.
| Compound Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 25045123 |
| Molecular Formula | C17H17N5O3S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-pyridin-3-ylthiourea |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=S)Nc3cccnc3)cc2)c1C |
| InChI | InChI=1S/C17H17N5O3S2/c1-11-12(2)21-25-16(11)22-27(23,24)15-7-5-13(6-8-15)19-17(26)20-14-4-3-9-18-10-14/h3-10,22H,1-2H3,(H2,19,20,26) |
| InChIKey | FACFCQYBEZOCPV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|