C21H24N4O3S2 — CID 25048651
1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 25048651) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 25048651 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 1-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=S)Nc3ccc(C(C)C)cc3)cc2)c1C |
| InChI | InChI=1S/C21H24N4O3S2/c1-13(2)16-5-7-17(8-6-16)22-21(29)23-18-9-11-19(12-10-18)30(26,27)25-20-14(3)15(4)24-28-20/h5-13,25H,1-4H3,(H2,22,23,29) |
| InChIKey | JMRXUCYHSZHETE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|