C29H27N7O8S2 — CID 4119855
2-N,6-N-bis[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]pyridine-2,6-dicarboxamide (PubChem CID 4119855) has the molecular formula C29H27N7O8S2 and a molecular weight of 665.71 g/mol. Its IUPAC name is 2-N,6-N-bis[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4119855 |
| Molecular Formula | C29H27N7O8S2 |
| Molecular Weight | 665.71 g/mol |
| Exact Mass | 665.14 |
| IUPAC Name | 2-N,6-N-bis[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]pyridine-2,6-dicarboxamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(C(=O)Nc4ccc(S(=O)(=O)Nc5onc(C)c5C)cc4)n3)cc2)c1C |
| InChI | InChI=1S/C29H27N7O8S2/c1-16-18(3)33-43-28(16)35-45(39,40)22-12-8-20(9-13-22)30-26(37)24-6-5-7-25(32-24)27(38)31-21-10-14-23(15-11-21)46(41,42)36-29-17(2)19(4)34-44-29/h5-15,35-36H,1-4H3,(H,30,37)(H,31,38) |
| InChIKey | YFHSOWBMHOMHNV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 215.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |