C19H16N4O4S — CID 108797463
3-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]benzamide (PubChem CID 108797463) has the molecular formula C19H16N4O4S and a molecular weight of 396.43 g/mol. Its IUPAC name is 3-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 3-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 108797463 |
| Molecular Formula | C19H16N4O4S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-cyano-N-[4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(C#N)c3)cc2)c1C |
| InChI | InChI=1S/C19H16N4O4S/c1-12-13(2)22-27-19(12)23-28(25,26)17-8-6-16(7-9-17)21-18(24)15-5-3-4-14(10-15)11-20/h3-10,23H,1-2H3,(H,21,24) |
| InChIKey | QOGAZKQLYSIUSI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |