C18H14N4O4S — CID 109065841
N-(3-cyanophenyl)-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide (PubChem CID 109065841) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide.
| Compound Name | N-(3-cyanophenyl)-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109065841 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-(3-cyanophenyl)-3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cccc(C(=O)Nc3cccc(C#N)c3)c2)no1 |
| InChI | InChI=1S/C18H14N4O4S/c1-12-8-17(21-26-12)22-27(24,25)16-7-3-5-14(10-16)18(23)20-15-6-2-4-13(9-15)11-19/h2-10H,1H3,(H,20,23)(H,21,22) |
| InChIKey | PJYKZJOJVVCQCJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |