C16H21N3O4S — CID 39157474
3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-pentylbenzamide (PubChem CID 39157474) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-pentylbenzamide.
| Compound Name | 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 39157474 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1cccc(S(=O)(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C16H21N3O4S/c1-3-4-5-9-17-16(20)13-7-6-8-14(11-13)24(21,22)19-15-10-12(2)23-18-15/h6-8,10-11H,3-5,9H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | JFKDWPVRKHWVKQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|