C16H19N3O3 — CID 109051241
1-N-butyl-3-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,3-dicarboxamide (PubChem CID 109051241) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-N-butyl-3-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051241 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-N-butyl-3-N-(5-methyl-1,2-oxazol-3-yl)benzene-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc(C(=O)Nc2cc(C)on2)c1 |
| InChI | InChI=1S/C16H19N3O3/c1-3-4-8-17-15(20)12-6-5-7-13(10-12)16(21)18-14-9-11(2)22-19-14/h5-7,9-10H,3-4,8H2,1-2H3,(H,17,20)(H,18,19,21) |
| InChIKey | XQOLDANEBFQDLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|