C16H19N3O5S — CID 109063959
3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 109063959) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 109063959 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cccc(C(=O)NCC3CCCO3)c2)no1 |
| InChI | InChI=1S/C16H19N3O5S/c1-11-8-15(18-24-11)19-25(21,22)14-6-2-4-12(9-14)16(20)17-10-13-5-3-7-23-13/h2,4,6,8-9,13H,3,5,7,10H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | RMRVOOKOIABUNJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |