C28H24N6O8S2 — CID 5175832
1-N,4-N-bis[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]benzene-1,4-dicarboxamide (PubChem CID 5175832) has the molecular formula C28H24N6O8S2 and a molecular weight of 636.67 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 5175832 |
| Molecular Formula | C28H24N6O8S2 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.11 |
| IUPAC Name | 1-N,4-N-bis[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]phenyl]benzene-1,4-dicarboxamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(C(=O)Nc4ccc(S(=O)(=O)Nc5cc(C)on5)cc4)cc3)cc2)no1 |
| InChI | InChI=1S/C28H24N6O8S2/c1-17-15-25(31-41-17)33-43(37,38)23-11-7-21(8-12-23)29-27(35)19-3-5-20(6-4-19)28(36)30-22-9-13-24(14-10-22)44(39,40)34-26-16-18(2)42-32-26/h3-16H,1-2H3,(H,29,35)(H,30,36)(H,31,33)(H,32,34) |
| InChIKey | BAMFOCNYJSUYLN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 202.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |