C20H21N3O4S — CID 109061783
4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 109061783) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 109061783 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(C(=O)Nc3ccc(C(C)C)cc3)cc2)no1 |
| InChI | InChI=1S/C20H21N3O4S/c1-13(2)15-4-8-17(9-5-15)21-20(24)16-6-10-18(11-7-16)28(25,26)23-19-12-14(3)27-22-19/h4-13H,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | IXWOEPZLISSKBF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |