C17H13F2N3O4S — CID 109061835
N-(2,6-difluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide (PubChem CID 109061835) has the molecular formula C17H13F2N3O4S and a molecular weight of 393.37 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide.
| Compound Name | N-(2,6-difluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109061835 |
| Molecular Formula | C17H13F2N3O4S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(C(=O)Nc3c(F)cccc3F)cc2)no1 |
| InChI | InChI=1S/C17H13F2N3O4S/c1-10-9-15(21-26-10)22-27(24,25)12-7-5-11(6-8-12)17(23)20-16-13(18)3-2-4-14(16)19/h2-9H,1H3,(H,20,23)(H,21,22) |
| InChIKey | WFXFQCISGBDIMF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |