C14H15N3O4S — CID 109058391
N-cyclopropyl-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide (PubChem CID 109058391) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is N-cyclopropyl-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109058391 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-cyclopropyl-4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(C(=O)NC3CC3)cc2)no1 |
| InChI | InChI=1S/C14H15N3O4S/c1-9-8-13(16-21-9)17-22(19,20)12-6-2-10(3-7-12)14(18)15-11-4-5-11/h2-3,6-8,11H,4-5H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | QCIKCZZKTJASPO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |