C18H20N2O3S — CID 109058325
N-cyclopropyl-4-[(2,6-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 109058325) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-cyclopropyl-4-[(2,6-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(2,6-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109058325 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-cyclopropyl-4-[(2,6-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-12-4-3-5-13(2)17(12)20-24(22,23)16-10-6-14(7-11-16)18(21)19-15-8-9-15/h3-7,10-11,15,20H,8-9H2,1-2H3,(H,19,21) |
| InChIKey | OPAICHJEGJIZRA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |