C20H20N4O6S — CID 25036468
[1-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate (PubChem CID 25036468) has the molecular formula C20H20N4O6S and a molecular weight of 444.47 g/mol. Its IUPAC name is [1-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate.
| Compound Name | [1-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 25036468 |
| Molecular Formula | C20H20N4O6S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [1-[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)C(C)OC(=O)c3ccc(N)cc3)cc2)no1 |
| InChI | InChI=1S/C20H20N4O6S/c1-12-11-18(23-30-12)24-31(27,28)17-9-7-16(8-10-17)22-19(25)13(2)29-20(26)14-3-5-15(21)6-4-14/h3-11,13H,21H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | KBEJZOUXKAVIEB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 153.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|