C22H23N5O5S — CID 25034889
[1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate (PubChem CID 25034889) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is [1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate.
| Compound Name | [1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 25034889 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [1-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]anilino]-1-oxopropan-2-yl] 4-aminobenzoate |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)C(C)OC(=O)c3ccc(N)cc3)cc2)n1 |
| InChI | InChI=1S/C22H23N5O5S/c1-13-12-14(2)25-22(24-13)27-33(30,31)19-10-8-18(9-11-19)26-20(28)15(3)32-21(29)16-4-6-17(23)7-5-16/h4-12,15H,23H2,1-3H3,(H,26,28)(H,24,25,27) |
| InChIKey | BJGBFAXGOWHXGU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|