C24H26N4O6S — CID 24671464
[1-oxo-1-[4-(pyrimidin-2-ylsulfamoyl)anilino]propan-2-yl] 4-(2-methylpropoxy)benzoate (PubChem CID 24671464) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is [1-oxo-1-[4-(pyrimidin-2-ylsulfamoyl)anilino]propan-2-yl] 4-(2-methylpropoxy)benzoate.
| Compound Name | [1-oxo-1-[4-(pyrimidin-2-ylsulfamoyl)anilino]propan-2-yl] 4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 24671464 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [1-oxo-1-[4-(pyrimidin-2-ylsulfamoyl)anilino]propan-2-yl] 4-(2-methylpropoxy)benzoate |
| SMILES | CC(C)COc1ccc(C(=O)OC(C)C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O6S/c1-16(2)15-33-20-9-5-18(6-10-20)23(30)34-17(3)22(29)27-19-7-11-21(12-8-19)35(31,32)28-24-25-13-4-14-26-24/h4-14,16-17H,15H2,1-3H3,(H,27,29)(H,25,26,28) |
| InChIKey | VSIYZTLLLWFDEA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |