C21H22N4O4S — CID 1305241
(2R)-2-(3,5-dimethylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 1305241) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is (2R)-2-(3,5-dimethylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | (2R)-2-(3,5-dimethylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 1305241 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (2R)-2-(3,5-dimethylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | Cc1cc(C)cc(O[C@H](C)C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)c1 |
| InChI | InChI=1S/C21H22N4O4S/c1-14-11-15(2)13-18(12-14)29-16(3)20(26)24-17-5-7-19(8-6-17)30(27,28)25-21-22-9-4-10-23-21/h4-13,16H,1-3H3,(H,24,26)(H,22,23,25)/t16-/m1/s1 |
| InChIKey | WFFKBFWGAIONAW-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |