C20H20N4O4S — CID 92681510
(2R)-2-(2-methylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 92681510) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is (2R)-2-(2-methylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | (2R)-2-(2-methylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 92681510 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (2R)-2-(2-methylphenoxy)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | Cc1ccccc1O[C@H](C)C(=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-14-6-3-4-7-18(14)28-15(2)19(25)23-16-8-10-17(11-9-16)29(26,27)24-20-21-12-5-13-22-20/h3-13,15H,1-2H3,(H,23,25)(H,21,22,24)/t15-/m1/s1 |
| InChIKey | WAEBLGDOPVAYHB-OAHLLOKOSA-N |
| XLogP | 2.99 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |