C10H11N3NaO3S — CID 57350054
CID 57350054 (PubChem CID 57350054) has the molecular formula C10H11N3NaO3S and a molecular weight of 276.27 g/mol.
| Compound Name | CID 57350054 |
|---|---|
| PubChem CID | 57350054 |
| Molecular Formula | C10H11N3NaO3S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | — |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1.[Na] |
| InChI | InChI=1S/C10H11N3O3S.Na/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9;/h2-6H,11H2,1H3,(H,12,13); |
| InChIKey | CFNQJJGJKVHAME-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|