C10H9N3O4S — CID 102025730
4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 102025730) has the molecular formula C10H9N3O4S and a molecular weight of 267.27 g/mol. Its IUPAC name is 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 102025730 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2cc(C=O)on2)cc1 |
| InChI | InChI=1S/C10H9N3O4S/c11-7-1-3-9(4-2-7)18(15,16)13-10-5-8(6-14)17-12-10/h1-6H,11H2,(H,12,13) |
| InChIKey | OWFSNHYARWRAJY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|