About 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide
4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 102025730) has the molecular formula C10H9N3O4S
and a molecular weight of 267.27 g/mol. Its IUPAC name is 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide |
| PubChem CID | 102025730 |
| Molecular Formula | C10H9N3O4S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2cc(C=O)on2)cc1 |
| InChI | InChI=1S/C10H9N3O4S/c11-7-1-3-9(4-2-7)18(15,16)13-10-5-8(6-14)17-12-10/h1-6H,11H2,(H,12,13) |
| InChIKey | OWFSNHYARWRAJY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide?
The IUPAC name of 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide (CID 102025730) is 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide.
What is the SMILES notation for 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide?
The canonical SMILES for 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide is Nc1ccc(S(=O)(=O)Nc2cc(C=O)on2)cc1.
What is the InChIKey of 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide?
The InChIKey is OWFSNHYARWRAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4S/c11-7-1-3-9(4-2-7)18(15,16)13-10-5-8(6-14)17-12-10/h1-6H,11H2,(H,12,13).
What are the key properties of 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide?
4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide has a molecular weight of 267.27 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(5-formyl-1,2-oxazol-3-yl)benzenesulfonamide is sourced from PubChem (CID 102025730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).