C21H22N6O6S2 — CID 149149977
N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methylamino]benzenesulfonamide (PubChem CID 149149977) has the molecular formula C21H22N6O6S2 and a molecular weight of 518.58 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methylamino]benzenesulfonamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 149149977 |
| Molecular Formula | C21H22N6O6S2 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[[4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]anilino]methylamino]benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NCNc3ccc(S(=O)(=O)Nc4cc(C)on4)cc3)cc2)no1 |
| InChI | InChI=1S/C21H22N6O6S2/c1-14-11-20(24-32-14)26-34(28,29)18-7-3-16(4-8-18)22-13-23-17-5-9-19(10-6-17)35(30,31)27-21-12-15(2)33-25-21/h3-12,22-23H,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | JGKOCMJGBNYOKL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|