C12H14BrN3O3S — CID 153356564
4-(2-bromoethylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 153356564) has the molecular formula C12H14BrN3O3S and a molecular weight of 360.23 g/mol. Its IUPAC name is 4-(2-bromoethylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-(2-bromoethylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 153356564 |
| Molecular Formula | C12H14BrN3O3S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 4-(2-bromoethylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NCCBr)cc2)no1 |
| InChI | InChI=1S/C12H14BrN3O3S/c1-9-8-12(15-19-9)16-20(17,18)11-4-2-10(3-5-11)14-7-6-13/h2-5,8,14H,6-7H2,1H3,(H,15,16) |
| InChIKey | SVCAYKSOWXIFHR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|