4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen

C11H11N5O2S — CID 174728998

IUPAC4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen
SMILESN#N.Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1
InChIInChI=1S/C11H11N3O2S.N2/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2/h1-8H,12H2,(H,13,14);
InChIKeyAWQFLQNVKFALCY-UHFFFAOYSA-N
MW277.31 g/mol
LogP1.49
Rot. Bonds3

About 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen

4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen (PubChem CID 174728998) has the molecular formula C11H11N5O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen.

Molecular Properties

Compound Name4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen
PubChem CID174728998
Molecular FormulaC11H11N5O2S
Molecular Weight277.31 g/mol
Exact Mass277.06
IUPAC Name4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen
SMILESN#N.Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1
InChIInChI=1S/C11H11N3O2S.N2/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2/h1-8H,12H2,(H,13,14);
InChIKeyAWQFLQNVKFALCY-UHFFFAOYSA-N
XLogP1.49
TPSA132.66 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.31
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
The IUPAC name of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen (CID 174728998) is 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen.
What is the SMILES notation for 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
The canonical SMILES for 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen is N#N.Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1.
What is the InChIKey of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
The InChIKey is AWQFLQNVKFALCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S.N2/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2/h1-8H,12H2,(H,13,14);.
What are the key properties of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen has a molecular weight of 277.31 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen is sourced from PubChem (CID 174728998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).