About 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen
4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen (PubChem CID 174728998) has the molecular formula C11H11N5O2S
and a molecular weight of 277.31 g/mol. Its IUPAC name is 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen.
Molecular Properties
| Compound Name | 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen |
| PubChem CID | 174728998 |
| Molecular Formula | C11H11N5O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen |
| SMILES | N#N.Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C11H11N3O2S.N2/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2/h1-8H,12H2,(H,13,14); |
| InChIKey | AWQFLQNVKFALCY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 132.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
The IUPAC name of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen (CID 174728998) is 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen.
What is the SMILES notation for 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
The canonical SMILES for 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen is N#N.Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1.
What is the InChIKey of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
The InChIKey is AWQFLQNVKFALCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2S.N2/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2/h1-8H,12H2,(H,13,14);.
What are the key properties of 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen?
4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen has a molecular weight of 277.31 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-pyridin-2-ylbenzenesulfonamide;molecular nitrogen is sourced from PubChem (CID 174728998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).