C12H12N4O2S2 — CID 87842258
[4-(pyridin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 87842258) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is [4-(pyridin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | [4-(pyridin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 87842258 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | [4-(pyridin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C12H12N4O2S2/c13-12(19)15-9-4-6-10(7-5-9)20(17,18)16-11-3-1-2-8-14-11/h1-8H,(H,14,16)(H3,13,15,19) |
| InChIKey | IDFGBGIHASXKFJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|