C19H17N3O3S2 — CID 21232687
2-phenylsulfanyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 21232687) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-phenylsulfanyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 21232687 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 2-phenylsulfanyl-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C19H17N3O3S2/c23-19(14-26-16-6-2-1-3-7-16)21-15-9-11-17(12-10-15)27(24,25)22-18-8-4-5-13-20-18/h1-13H,14H2,(H,20,22)(H,21,23) |
| InChIKey | UQHZDMDBHAGRQG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |