C25H22N4O3S — CID 1164323
3,3-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 1164323) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is 3,3-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3,3-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 1164323 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3,3-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C25H22N4O3S/c30-24(18-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20)28-21-12-14-22(15-13-21)33(31,32)29-25-26-16-7-17-27-25/h1-17,23H,18H2,(H,28,30)(H,26,27,29) |
| InChIKey | JDVOCRIIDFQKFM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |