C18H15N5O4S — CID 1179236
N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]benzamide (PubChem CID 1179236) has the molecular formula C18H15N5O4S and a molecular weight of 397.42 g/mol. Its IUPAC name is N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]benzamide.
| Compound Name | N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 1179236 |
| Molecular Formula | C18H15N5O4S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C18H15N5O4S/c24-16(13-5-2-1-3-6-13)22-18(25)21-14-7-9-15(10-8-14)28(26,27)23-17-19-11-4-12-20-17/h1-12H,(H,19,20,23)(H2,21,22,24,25) |
| InChIKey | VNTNZGRKQBFITB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 130.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |