C17H13FN4O3S — CID 2521510
3-fluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 2521510) has the molecular formula C17H13FN4O3S and a molecular weight of 372.38 g/mol. Its IUPAC name is 3-fluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2521510 |
| Molecular Formula | C17H13FN4O3S |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 3-fluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H13FN4O3S/c18-13-4-1-3-12(11-13)16(23)21-14-5-7-15(8-6-14)26(24,25)22-17-19-9-2-10-20-17/h1-11H,(H,21,23)(H,19,20,22) |
| InChIKey | TZANHCUGGQHQBK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |