C17H9F5N4O3S — CID 2169475
2,3,4,5,6-pentafluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 2169475) has the molecular formula C17H9F5N4O3S and a molecular weight of 444.34 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2169475 |
| Molecular Formula | C17H9F5N4O3S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H9F5N4O3S/c18-11-10(12(19)14(21)15(22)13(11)20)16(27)25-8-2-4-9(5-3-8)30(28,29)26-17-23-6-1-7-24-17/h1-7H,(H,25,27)(H,23,24,26) |
| InChIKey | DBYBBLBLGCWWQG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|