C16H13FN4O4S2 — CID 1164234
4-[(4-fluorophenyl)sulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 1164234) has the molecular formula C16H13FN4O4S2 and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 1164234 |
| Molecular Formula | C16H13FN4O4S2 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN4O4S2/c17-12-2-6-14(7-3-12)26(22,23)20-13-4-8-15(9-5-13)27(24,25)21-16-18-10-1-11-19-16/h1-11,20H,(H,18,19,21) |
| InChIKey | SIHXBWYKQIJYKE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |