C18H17FN4O5S2 — CID 90518562
4-[2-(4-fluorophenoxy)ethylsulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 90518562) has the molecular formula C18H17FN4O5S2 and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-[2-(4-fluorophenoxy)ethylsulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 4-[2-(4-fluorophenoxy)ethylsulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 90518562 |
| Molecular Formula | C18H17FN4O5S2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-[2-(4-fluorophenoxy)ethylsulfonylamino]-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | O=S(=O)(CCOc1ccc(F)cc1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C18H17FN4O5S2/c19-14-2-6-16(7-3-14)28-12-13-29(24,25)22-15-4-8-17(9-5-15)30(26,27)23-18-20-10-1-11-21-18/h1-11,22H,12-13H2,(H,20,21,23) |
| InChIKey | KKFFOCKHJSCTLE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |