C18H18FNO4S — CID 110618586
N-[4-(cyclopropanecarbonyl)phenyl]-2-(4-fluorophenoxy)ethanesulfonamide (PubChem CID 110618586) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[4-(cyclopropanecarbonyl)phenyl]-2-(4-fluorophenoxy)ethanesulfonamide.
| Compound Name | N-[4-(cyclopropanecarbonyl)phenyl]-2-(4-fluorophenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 110618586 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[4-(cyclopropanecarbonyl)phenyl]-2-(4-fluorophenoxy)ethanesulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)CCOc2ccc(F)cc2)cc1)C1CC1 |
| InChI | InChI=1S/C18H18FNO4S/c19-15-5-9-17(10-6-15)24-11-12-25(22,23)20-16-7-3-14(4-8-16)18(21)13-1-2-13/h3-10,13,20H,1-2,11-12H2 |
| InChIKey | SSOMCMMGEUAAOG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |