C17H20FNO6S — CID 110299951
2-(4-fluorophenoxy)-N-(3,4,5-trimethoxyphenyl)ethanesulfonamide (PubChem CID 110299951) has the molecular formula C17H20FNO6S and a molecular weight of 385.41 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(3,4,5-trimethoxyphenyl)ethanesulfonamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(3,4,5-trimethoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110299951 |
| Molecular Formula | C17H20FNO6S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(3,4,5-trimethoxyphenyl)ethanesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)CCOc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20FNO6S/c1-22-15-10-13(11-16(23-2)17(15)24-3)19-26(20,21)9-8-25-14-6-4-12(18)5-7-14/h4-7,10-11,19H,8-9H2,1-3H3 |
| InChIKey | WSJZZXAMGCZTQC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |