C15H18N2O6S2 — CID 90518362
4-[2-(4-methoxyphenoxy)ethylsulfonylamino]benzenesulfonamide (PubChem CID 90518362) has the molecular formula C15H18N2O6S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenoxy)ethylsulfonylamino]benzenesulfonamide.
| Compound Name | 4-[2-(4-methoxyphenoxy)ethylsulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 90518362 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-[2-(4-methoxyphenoxy)ethylsulfonylamino]benzenesulfonamide |
| SMILES | COc1ccc(OCCS(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H18N2O6S2/c1-22-13-4-6-14(7-5-13)23-10-11-24(18,19)17-12-2-8-15(9-3-12)25(16,20)21/h2-9,17H,10-11H2,1H3,(H2,16,20,21) |
| InChIKey | RKWMSQVWAXSYIZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |