C18H21NO7S — CID 34429524
2-(4-sulfamoylphenoxy)ethyl 3-(4-methoxyphenoxy)propanoate (PubChem CID 34429524) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 3-(4-methoxyphenoxy)propanoate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 3-(4-methoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 34429524 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 3-(4-methoxyphenoxy)propanoate |
| SMILES | COc1ccc(OCCC(=O)OCCOc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H21NO7S/c1-23-14-2-4-15(5-3-14)24-11-10-18(20)26-13-12-25-16-6-8-17(9-7-16)27(19,21)22/h2-9H,10-13H2,1H3,(H2,19,21,22) |
| InChIKey | ADTHKYCMIUIUQZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|