C19H22N2O6S — CID 34373179
2-(4-sulfamoylphenoxy)ethyl 2-[(3,5-dimethylbenzoyl)amino]acetate (PubChem CID 34373179) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 2-[(3,5-dimethylbenzoyl)amino]acetate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 2-[(3,5-dimethylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 34373179 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 2-[(3,5-dimethylbenzoyl)amino]acetate |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)OCCOc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H22N2O6S/c1-13-9-14(2)11-15(10-13)19(23)21-12-18(22)27-8-7-26-16-3-5-17(6-4-16)28(20,24)25/h3-6,9-11H,7-8,12H2,1-2H3,(H,21,23)(H2,20,24,25) |
| InChIKey | MVIATBGVNZZGKK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|