C12H20N2O4S — CID 47294827
4-[2-[2-methoxyethyl(methyl)amino]ethoxy]benzenesulfonamide (PubChem CID 47294827) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-[2-[2-methoxyethyl(methyl)amino]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[2-methoxyethyl(methyl)amino]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 47294827 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-[2-[2-methoxyethyl(methyl)amino]ethoxy]benzenesulfonamide |
| SMILES | COCCN(C)CCOc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H20N2O4S/c1-14(7-9-17-2)8-10-18-11-3-5-12(6-4-11)19(13,15)16/h3-6H,7-10H2,1-2H3,(H2,13,15,16) |
| InChIKey | YMBQKXQZCCVEFJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |