C17H22N2O6S2 — CID 56564058
4-[2-(4-methoxyphenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide (PubChem CID 56564058) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide.
| Compound Name | 4-[2-(4-methoxyphenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 56564058 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 4-[2-(4-methoxyphenoxy)ethyl-methylamino]-3-methylsulfonylbenzenesulfonamide |
| SMILES | COc1ccc(OCCN(C)c2ccc(S(N)(=O)=O)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H22N2O6S2/c1-19(10-11-25-14-6-4-13(24-2)5-7-14)16-9-8-15(27(18,22)23)12-17(16)26(3,20)21/h4-9,12H,10-11H2,1-3H3,(H2,18,22,23) |
| InChIKey | IFXUUPXVGFGGES-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |