C7H10KNO3S — CID 173359933
potassium;hydride;4-methoxybenzenesulfonamide (PubChem CID 173359933) has the molecular formula C7H10KNO3S and a molecular weight of 227.33 g/mol. Its IUPAC name is potassium;hydride;4-methoxybenzenesulfonamide.
| Compound Name | potassium;hydride;4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 173359933 |
| Molecular Formula | C7H10KNO3S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | potassium;hydride;4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1.[H-].[K+] |
| InChI | InChI=1S/C7H9NO3S.K.H/c1-11-6-2-4-7(5-3-6)12(8,9)10;;/h2-5H,1H3,(H2,8,9,10);;/q;+1;-1 |
| InChIKey | PGJPHOCTGVQJOP-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |