C15H14BrNO4S — CID 18756147
4-[1-bromo-2-(4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide (PubChem CID 18756147) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is 4-[1-bromo-2-(4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | 4-[1-bromo-2-(4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 18756147 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 4-[1-bromo-2-(4-methoxyphenyl)-2-oxoethyl]benzenesulfonamide |
| SMILES | COc1ccc(C(=O)C(Br)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H14BrNO4S/c1-21-12-6-2-11(3-7-12)15(18)14(16)10-4-8-13(9-5-10)22(17,19)20/h2-9,14H,1H3,(H2,17,19,20) |
| InChIKey | UNNFKIGEZGSMLJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|