C14H16N2O5S2 — CID 26527057
4-N-[(4-methoxyphenyl)methyl]benzene-1,4-disulfonamide (PubChem CID 26527057) has the molecular formula C14H16N2O5S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-N-[(4-methoxyphenyl)methyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[(4-methoxyphenyl)methyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 26527057 |
| Molecular Formula | C14H16N2O5S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4-N-[(4-methoxyphenyl)methyl]benzene-1,4-disulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H16N2O5S2/c1-21-12-4-2-11(3-5-12)10-16-23(19,20)14-8-6-13(7-9-14)22(15,17)18/h2-9,16H,10H2,1H3,(H2,15,17,18) |
| InChIKey | HDOXHNGTNSUTEY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |