C14H15BrN2O5S2 — CID 4843656
3-bromo-4-methoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide (PubChem CID 4843656) has the molecular formula C14H15BrN2O5S2 and a molecular weight of 435.32 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4843656 |
| Molecular Formula | C14H15BrN2O5S2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | 3-bromo-4-methoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1Br |
| InChI | InChI=1S/C14H15BrN2O5S2/c1-22-14-7-6-12(8-13(14)15)24(20,21)17-9-10-2-4-11(5-3-10)23(16,18)19/h2-8,17H,9H2,1H3,(H2,16,18,19) |
| InChIKey | YGGMMQAXNARVDZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |