C15H17BrN2O6S2 — CID 55387268
2-bromo-4,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide (PubChem CID 55387268) has the molecular formula C15H17BrN2O6S2 and a molecular weight of 465.35 g/mol. Its IUPAC name is 2-bromo-4,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide.
| Compound Name | 2-bromo-4,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55387268 |
| Molecular Formula | C15H17BrN2O6S2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 463.97 |
| IUPAC Name | 2-bromo-4,5-dimethoxy-N-[(4-sulfamoylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)NCc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C15H17BrN2O6S2/c1-23-13-7-12(16)15(8-14(13)24-2)26(21,22)18-9-10-3-5-11(6-4-10)25(17,19)20/h3-8,18H,9H2,1-2H3,(H2,17,19,20) |
| InChIKey | NOMSIUYOJUJGDV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |