C12H17BrN2O4S — CID 43597871
N-(3-aminocyclobutyl)-2-bromo-4,5-dimethoxybenzenesulfonamide (PubChem CID 43597871) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is N-(3-aminocyclobutyl)-2-bromo-4,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-aminocyclobutyl)-2-bromo-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43597871 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-(3-aminocyclobutyl)-2-bromo-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)NC2CC(N)C2)cc1OC |
| InChI | InChI=1S/C12H17BrN2O4S/c1-18-10-5-9(13)12(6-11(10)19-2)20(16,17)15-8-3-7(14)4-8/h5-8,15H,3-4,14H2,1-2H3 |
| InChIKey | WXEFAQNHQLSYRR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |